LBF22109SC02
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0129 |
LipidMaps | LMFA01030090 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF22109SC02.mol |
trans-Brassidic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | trans-13-Docosenoic acid |
Common Name |
|
Symbol | |
Formula | C22H42O2 |
Exact Mass | 338.318480588 |
Average Mass | 338.56768000000005 |
SMILES | C(CCC(O)=O)CCCCCCCCC=CCCCCCCCC |
Physicochemical Information | |
Melting Point | 61.9°C |
Boiling Point | 265°C at 15 mmHg |
Density | dX470 0.85002 |
Optical Rotation | 1.44349 at 70°C |
Reflactive Index | |
Solubility | sparingly solbule in cold ethanol <<0091>> <<0096>> <<0097>> <<0550>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |