LBF21304HP01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA8070 |
LipidMaps | LMFA01040054 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF21304HP01.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl-8- [ 3,5-Epidioxy-2- (3-Hydroperoxy-1-Pentenyl) Cyclopentyl ] Octanoate |
Common Name | |
Symbol | |
Formula | C19H32O6 |
Exact Mass | 356.219888756 |
Average Mass | 356.45378 |
SMILES | C(C2CCCCCCCC(=O)OC)(O1)CC(C2C=CC(CC)OO)O1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction and hydrogenation and TMS-derivatization)<<8084>>: m/e=545[M-CH3]; 455[545-HOTMS]; 401[M-(CH2)2CH(OTMS)CH2CH3]; 131[SMTO=CHCH2CH3] |
UV Spectra | |
IR Spectra | OOH group: 3620-3010cm-1[bonded], 3520cm-1[free]; isolated trans unsaturation: 960cm-1<<8084>> |
NMR Spectra | |
Chromatograms |