LBF20806AM02
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR7068 |
LipidMaps | LMFA08020054 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20806AM02.mol |
Structural Information | |
---|---|
Systematic Name | arachidonoyl- (2'-phenoxyethyl) amide |
Common Name | |
Symbol | |
Formula | C28H41NO2 |
Exact Mass | 423.313729561 |
Average Mass | 423.63068 |
SMILES | C(=CCCCC(NCCOc(c1)cccc1)=O)CC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |