LBF20806AM01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7044 | |LipidBank=XPR7044 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7044 |
| LipidMaps | LMFA08020030 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20806AM01.mol |
| |
| Structural Information | |
| Systematic Name | (+-) -N- (1-methyl-2-hydroxy-2-phenylethyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C29H43NO2 |
| Exact Mass | 437.329379625 |
| Average Mass | 437.65725999999995 |
| SMILES | C(=CCC=CCC=CCCCC(=O)NC(C(O)c(c1)cccc1)C)CC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d7.27-7.35 (m, 5H), 5.54 (br s , lH), 5.63-5.41 (m, 8H), 4.84 (br s, lH),4.31-4.36 (m, lH), 3.60 (br s, lH), 2.78-2.85 (m, 6H), 2.01-2.22 (m, 6H), 1.67-1.77 (m, 2H),1.25-1.37 (m, 6H), 1.01 (d, J=7.l Hz, 3H), 0.89 (t, J=7.l Hz, 3H). <<7001>> |
| Chromatograms | |
