LBF20506AM01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7066 | |LipidBank=XPR7066 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7066 |
| LipidMaps | LMFA08020052 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20506AM01.mol |
| |
| Structural Information | |
| Systematic Name | arachidonoylmorpholine |
| Common Name | |
| Symbol | |
| Formula | C24H39NO2 |
| Exact Mass | 373.298079497 |
| Average Mass | 373.572 |
| SMILES | O=C(N(C1)CCOC1)CCCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
