LBF20503HO06
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA8124 |
LipidMaps | LMFA03070007 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20503HO06.mol |
Structural Information | |
---|---|
Systematic Name | 12R-hydroxy-5Z,8Z,12E,14Z,17Z-Eicosapentaenoic acid |
Common Name | |
Symbol | |
Formula | C20H30O3 |
Exact Mass | 318.21949482599996 |
Average Mass | 318.4504 |
SMILES | C(CC=CC=C(CCC=CCC=CCCCC(O)=O)O)=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax: 237nm e: 23,000 |
IR Spectra | |
NMR Spectra | |
Chromatograms |