LBF20502SC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0219 |
| LipidMaps | LMFA01030180 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20502SC01.mol |
| Timnodonic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4, 8, 12, 15, 18-Eicosapentaenoic acid / 4, 8, 12, 15, 18-icosapentaenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H30O2 |
| Exact Mass | 302.224580204 |
| Average Mass | 302.451 |
| SMILES | C(C=CCC=CCCC=CCCC=CCCC(O)=O)C=CC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | 0.9399 at 15 °C |
| Optical Rotation | 1.5109 at 15 °C |
| Reflactive Index | |
| Solubility | soluble in benzene, chloroform, ether and petroleum ether.<<0489>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
