LBF20407LX01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8153 | |LipidBank=DFA8153 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8153 |
LipidMaps | LMFA03040001 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20407LX01.mol |
lipoxin A_4 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5S,6R,15S-trihydroxy-7E,9E,11Z,13E-eicosatetraenoic acid |
Common Name |
|
Symbol | |
Formula | C20H32O5 |
Exact Mass | 352.224974134 |
Average Mass | 352.46508 |
SMILES | C(CCC(C=CC=CC=CC=CC(O)C(O)CCCC(O)=O)O)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax: 302nm e: 50,000 |
IR Spectra | |
NMR Spectra | |
Chromatograms |