LBF20406PH01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR7016 |
LipidMaps | LMFA08020002 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406PH01.mol |
![]() | |
Structural Information | |
Systematic Name | anandamide 0-phosphate |
Common Name | |
Symbol | |
Formula | C22H38NO5P |
Exact Mass | 427.2487598409999 |
Average Mass | 427.51462100000003 |
SMILES | C(CCCC=CCC=CCC=CCC=CCCCCC)(NCCOP(O)(O)=O)=O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.34-5.42 (m, 8H), 3.98 (br s 2H), 3.46 (br s 2H), 2.77-2.81 (m, 6H), 2.26 (t, J=6.8Hz, 2H), 2.00-2.06 (m, 4H), 1.60-1.69 (m, 2H), 1.29-1.42 (m, 6H), 0.88 (t, J=6.9Hz,3H) <<7001>> |
Chromatograms |