LBF20406PG02
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR1766 |
LipidMaps | LMFA03010021 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406PG02.mol |
15-deoxy-Delta^{12.14}-Prostaglandin J2 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 11-oxo-prosta-5Z,9,12E,14Z-tetraen-1-oic acid |
Common Name |
|
Symbol | |
Formula | C20H28O3 |
Exact Mass | 316.203844762 |
Average Mass | 316.43452 |
SMILES | C(CC=CC=C(C(=O)1)[C@@H](CC=CCCCC(O)=O)C=C1)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |