LBF20406LT11
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR3120 |
LipidMaps | LMFA03020018 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406LT11.mol |
20-hydroxy Leukotriene B4 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5S,12R,20-trihydroxy-6Z,8E,10E,14Z-eicosatetraenoic acid |
Common Name |
|
Symbol | |
Formula | C20H32O5 |
Exact Mass | 352.224974134 |
Average Mass | 352.46508 |
SMILES | C(CCC=CC[C@H](C=CC=CC=C[C@H](CCCC(O)=O)O)O)CCO |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |