LBF20406LT08
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR3117 |
LipidMaps | LMFA03020015 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406LT08.mol |
12-epi Leukotriene B4 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5S,12S-dihydroxy-6Z,8E,10E,14Z-eicsatetraenoic acid |
Common Name |
|
Symbol | |
Formula | C20H32O4 |
Exact Mass | 336.23005951199997 |
Average Mass | 336.46567999999996 |
SMILES | C(CC=CC[C@@H](C=CC=CC=C[C@@H](CCCC(O)=O)O)O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |