LBF20406LT05
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR3114 |
LipidMaps | LMFA03020012 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406LT05.mol |
Leukotriene B4 Ethanolamide | |
---|---|
![]() | |
Structural Information | |
Systematic Name | N- (2-hydroxyethyl) -5S,12R-dihydroxy-6Z,8E,10E,14Z-eicosatetraenamide |
Common Name |
|
Symbol | |
Formula | C22H37NO4 |
Exact Mass | 379.27225867699997 |
Average Mass | 379.53352 |
SMILES | C(=CC[C@@H](O)C=CC=CC=C[C@H](CCCC(=O)NCCO)O)CCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |