LBF20406HO09
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA8127 |
LipidMaps | LMFA03060023 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HO09.mol |
![]() | |
Structural Information | |
Systematic Name | 3R-hydroxy-5Z,8Z,11Z,14Z-eicosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C20H32O3 |
Exact Mass | 320.23514489 |
Average Mass | 320.46628 |
SMILES | OC(CC=CCC=CCC=CCC=CCCCCC)CC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |