LBF20406HO08
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8103 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406HO08.mol |
| |
| Structural Information | |
| Systematic Name | 5S,6S-dihydroxy-7E,9E,11Z,14Z-eicosatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C20H32O4 |
| Exact Mass | 336.23005951199997 |
| Average Mass | 336.46567999999996 |
| SMILES | C(CC=CCC=CC=CC=C[C@H](O)[C@@H](O)CCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax:273nm e:40,000 |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
