LBF20406AM37
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR7054 |
LipidMaps | LMFA08020040 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM37.mol |
![]() | |
Structural Information | |
Systematic Name | N- (1-methyl-2-hydroxyethyl) arachidonoylamide (R) |
Common Name | |
Symbol | |
Formula | C23H39NO2 |
Exact Mass | 361.298079497 |
Average Mass | 361.5613 |
SMILES | C(CCC(=O)N[C@@H](CO)C)C=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless liquid <<7012>. |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | dX425= +10.9° <<7012>> |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (200 MHz, CDCl3) d(TMS)5.57 (m, 1H), 5.47-5.30 (m, 8H), 4.14-4.02 (m, 1H), 3.71-3.48 (m, 2H), 2.84-2.81 (m, 6H), 2.24-2.01 (m, 6H), 1.77-1.65 (m, 2H), 1.39-1.26 (m, 6H), 1.17 (d, J=3.46Hz, 3H), 0.89 (t, J=6.12Hz, 3H) <<7012>> |
Chromatograms | Rf 0.3(5% MeOH/CHCl3) <<0012>> |