LBF20406AM31
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7048 | |LipidBank=XPR7048 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7048 |
| LipidMaps | LMFA08020034 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM31.mol |
| |
| Structural Information | |
| Systematic Name | N-propyl alpha,alpha-dimethylarachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO |
| Exact Mass | 373.334465003 |
| Average Mass | 373.61505999999997 |
| SMILES | C(CC=CCCC(C)(C)C(NCCC)=O)=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.60 (br s, lH), 5.30-5.40 (m, 8H), 3.20-3.23 (m, 2H), 2.79-2.84 (m, 6H), 2.00-2.10 (m, 4H), 1.20-1.60 (series of m, 10H), 1.15 (s, 6H), 0.86-0.94 (m, 6H). <<7001>> |
| Chromatograms | |
