LBF20406AM27
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7043 |
| LipidMaps | LMFA08020029 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM27.mol |
| |
| Structural Information | |
| Systematic Name | N-hydroxy -N-arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C20H33NO2 |
| Exact Mass | 319.251129305 |
| Average Mass | 319.48156 |
| SMILES | C(CC=CCC=CCC=CCC=CCCCC(NO)=O)CCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.43 (m, 8H), 2.78-2.86 (m, 6H), 2.02-2.17 (m, 6H), l.70-1.78(m, 2H), 1.22-1.38 (m, 6H), 0.89 (t, J=6.9 Hz, 3H). <<7001>> |
| Chromatograms | |
