LBF20406AM24
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7040 | |LipidBank=XPR7040 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7040 |
LipidMaps | LMFA08020026 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM24.mol |
Structural Information | |
---|---|
Systematic Name | N-ethyl -N- (2-hydroxyethyl) arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C24H41NO2 |
Exact Mass | 375.313729561 |
Average Mass | 375.58788 |
SMILES | N(C(=O)CCCC=CCC=CCC=CCC=CCCCCC)(CCO)CC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.31-5.42 (m, 8H), 3.75 (t, J=4.6 Hz, 2H), 3.51 (t, J=4.6Hz, 2H), 3.34(q, J=7.l Hz, 2H), 3.34 (q, J=7.l Hz, 2H), 2.79-2.86 (m, 6H), 2.35 (t, J=7.8Hz, 2H), 2.04-2.15(m, 4H), 1.64-1.77 (m, 2H), 1.25-1.40 (m, 6H), 1.19 (t, J=7.l Hz, 3H), 0.89 (t, J=7.lHz, 3H).<<7001>> |
Chromatograms |