LBF20406AM21
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR7037 |
LipidMaps | LMFA08020023 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM21.mol |
Structural Information | |
---|---|
Systematic Name | N,N-dimethyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C22H37NO |
Exact Mass | 331.287514811 |
Average Mass | 331.53532 |
SMILES | C(CCC(N(C)C)=O)C=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.24-5.44 (m, 8H), 2.99 (s, 3H), 2.94 (s, 3H), 2.76-2.86 (m, 6H), 2.31 (t, J=7Hz, 2H), 2.00-2.18 (m, 4H), 1.66-1.78 (m, 2H), 1.20-1.38 (m, 6H), 0.89 (t, J=7.lHz, 3H)<<7001>> |
Chromatograms |