LBF20406AM19
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7035 | |LipidBank=XPR7035 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7035 |
LipidMaps | LMFA08020021 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM19.mol |
![]() | |
Structural Information | |
Systematic Name | N- (2-methoxyethyl) arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C23H39NO2 |
Exact Mass | 361.298079497 |
Average Mass | 361.5613 |
SMILES | O(C)CCNC(=O)CCCC=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.80 (br s lH), 5.30-5.42 (m, 8H), 3.45 (d, J=2.1Hz, 4H), 3.35 (s, 3H), 2.75-2.85 (m, 6H), 2.00-2.20 (m, 6H), 1.62-1.80 (m, 2H), 1.20-1.40 (m, 6H), 0.89 (t, J=6.8Hz, 3H) <<7001>> |
Chromatograms |