LBF20406AM16
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7032 | |LipidBank=XPR7032 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7032 |
| LipidMaps | LMFA08020018 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM16.mol |
| |
| Structural Information | |
| Systematic Name | N- (3-hydroxypropyl) arachidonoylamide |
| Common Name | |
| Symbol | |
| Formula | C23H39NO2 |
| Exact Mass | 361.298079497 |
| Average Mass | 361.5613 |
| SMILES | C(O)CCNC(=O)CCCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<0001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d6.42 (br s lH), 5.22-5.38 (m, 8H), 3.90 (br s, lH), 3.54 (t, J=5.5 Hz, 2H), 3.32 (q, J=6Hz, 2H), 2.62-2.80 (m, 6H), 1.92-2.18 (m, 6H), 1.50-1.70 (m, 4H), 1.20-1.3 (m, 6H), 0.90 (t, J=7Hz, 3H). <<7001>> |
| Chromatograms | |
