LBF20406AM13
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7029 |
| LipidMaps | LMFA08020015 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM13.mol |
| |
| Structural Information | |
| Systematic Name | N- (1,1-dimethylpropyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO |
| Exact Mass | 373.334465003 |
| Average Mass | 373.61505999999997 |
| SMILES | C(NC(C)(C)CC)(=O)CCCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.28-5.38 (m, 8H), 5.10 (br s, lH), 2.67-2.82 (m, 6H), 2.04-2.12 (m, 6H), 1.66-1.76 (m, 4H), 1.24-1.32 (m, l2 H), 0.81-0.90 (m, 6H). <<7001>> |
| Chromatograms | |
