LBF20406AM08
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7024 | |LipidBank=XPR7024 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7024 |
| LipidMaps | LMFA08020010 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM08.mol |
| |
| Structural Information | |
| Systematic Name | N-isopropyl arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C23H39NO |
| Exact Mass | 345.303164875 |
| Average Mass | 345.5619 |
| SMILES | C(CCCC=CCC=CCC=CCC=CCCCCC)(NC(C)C)=O |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.44 (m, 8H), 4.02-4.12 (m, 1H), 2.76-2.86 (m, 6H), 2.02-2.16 (m, 6H), 1.66-1.76 (m, 2H), 1.26-1.38 (m, 6H), 1.14 (d, J=6.6Hz, 6H), 0.89 (t, J=6.9Hz, 3H) <<7001>> |
| Chromatograms | |
