LBF20406AM04
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7020 | |LipidBank=XPR7020 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7020 |
| LipidMaps | LMFA08020006 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM04.mol |
| |
| Structural Information | |
| Systematic Name | N-ethyl arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C22H37NO |
| Exact Mass | 331.287514811 |
| Average Mass | 331.53532 |
| SMILES | C(CCC(NCC)=O)C=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.31-5.41 (m, 8H), 3.22-3.34 (m, 2H), 2.78-2.84 (m, 6H), 1.68-1.78 (m, 4H), 1.22-1.40 (m, 6H), 1.13 (t, J=7.3, 3H), 0.88 (t, J=7.1H, 3H) <<7001>> |
| Chromatograms | |
