LBF20406AM02
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR7018 |
LipidMaps | LMFA08020004 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM02.mol |
![]() | |
Structural Information | |
Systematic Name | N-arachidonoyl-D-serine |
Common Name | |
Symbol | |
Formula | C23H37NO4 |
Exact Mass | 391.27225867699997 |
Average Mass | 391.54422 |
SMILES | [C@H](CO)(C(O)=O)NC(CCCC=CCC=CCC=CCC=CCCCCC)=O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | dX425= -8.9°(C=1,CHCl3)<<7001>> |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CD3OD) d5.30-5.43 (m, 8H), 4.49 (t, J=4.8Hz, 1H), 3.80-3.88 (m, 2H), 2.80-2.86 (m, 6H), 2.30 (t, J=6.6Hz, 2H), 2.04-2.18 (m, 4H), 1.66-1.72 (m, 2H), 1.29-1.39 (m, 6H), 0.90 (t, J=6.9Hz, 3H) <<7001>> |
Chromatograms |