LBF20406AM01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7017 |
| LipidMaps | LMFA08020003 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM01.mol |
| |
| Structural Information | |
| Systematic Name | N-arachidonoylglycine |
| Common Name | |
| Symbol | |
| Formula | C22H35NO3 |
| Exact Mass | 361.261693991 |
| Average Mass | 361.51824 |
| SMILES | C(CCCC=CCC=CCC=CCC=CCCCCC)(NCC(O)=O)=O |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d6.25 (br s 1H), 5.30-5.37 (m, 8H), 4.05 (d, J=5.1Hz, 2H), 2.76-2.82 (m, 6H), 2.22 (t, J=7.8Hz, 2H), 2.04-2.18 (m, 2H), 1.70-1.82 (m, 4H), 1.25-1.35 (m, 6H), 0.89 (t, J=7.1Hz, 3H) <<7001>> |
| Chromatograms | |
