LBF20309SC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0196 |
LipidMaps | LMFA01030157 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20309SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 5, 8, 11-Eicosatrienoic acid / 5, 8, 11-icosatrienoic acid |
Common Name | |
Symbol | |
Formula | C20H34O2 |
Exact Mass | 306.255880332 |
Average Mass | 306.48276000000004 |
SMILES | C(CCCCC=CCC=CCC=CCCCC(O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | solubule in CS2, heptane and methylalcohol.<<0292>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |