LBF20307PG03
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR1101 |
LipidMaps | LMFA03010018 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20307PG03.mol |
PROSTAGLANDIN B2 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 7- [ 2- (3 (S) -Hydroxy-1 (E) -octenyl) -5-oxo-1-cyclopenten-1-yl ] -5 (Z) -heptenoic acid |
Common Name |
|
Symbol | |
Formula | C20H30O4 |
Exact Mass | 334.21440944799997 |
Average Mass | 334.4498 |
SMILES | C(CC[C@@H](O)C=CC(=C1CC=CCCCC(O)=O)CCC(=O)1)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | METHYL ESTER; m/e 348(M+), 317, 249, 247, 245, 217, 215, 133, 119, 109 <<1046>> |
UV Spectra | MeOH: 278 nm (e 26000) <<1045>> |
IR Spectra | |
NMR Spectra | METHYL ESTER ; 1H-NMR : d 6.9(d, J=16Hz, 1H, 13-CH), 6.3(dd, J=5.5, 16Hz, 1H,14-CH), 5.7-5.1(m, 2H), 4.5-4.1(m, 1H, 15-CH), 3.65(S, 3H, OCH3), 3.15-2.85(m, 2H, 7-CH) <<1046>> |
Chromatograms |