LBF20306HX02
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | XPR5111 |
LipidMaps | LMFA03090004 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20306HX02.mol |
TRIOXILIN B3 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 10,11 (S) ,12 (R) -Trihydroxyeicosa-5,8,14 (Z,Z,Z) -trienoic acid |
Common Name |
|
Symbol | |
Formula | C20H34O5 |
Exact Mass | 354.240624198 |
Average Mass | 354.48096000000004 |
SMILES | [C@@H](O)([C@@H](C(O)C=CCC=CCCCC(O)=O)O)CC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | METHYL ESTER TRIS-TMS ETHER ; m/e 342, 315, 269, 225, 213, 129(base peak) <<1074>> |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |