LBF20207PG10
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1728 | |LipidBank=XPR1728 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR1728 |
LipidMaps | LMFA03010047 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20207PG10.mol |
15-epi Prostaglandin A1 | |
---|---|
Structural Information | |
Systematic Name | 9-oxo-15R-hydroxy-prostsa-10,13E-dien-1-oic acid |
Common Name |
|
Symbol | |
Formula | C20H32O4 |
Exact Mass | 336.23005951199997 |
Average Mass | 336.46567999999996 |
SMILES | C(CC[C@H](O)C=C[C@H]([C@H]1CCCCCCC(O)=O)C=CC(=O)1) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |