LBF192nnXX01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0261 |
LipidMaps | LMFA01030190 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF192nnXX01.mol |
Sterculic acid | |
---|---|
Structural Information | |
Systematic Name | omega- (2-n-Octylcycloprop-1-enyl) octanoic acid |
Common Name |
|
Symbol | |
Formula | C19H34O2 |
Exact Mass | 294.255880332 |
Average Mass | 294.47206000000006 |
SMILES | C(=C(CCCCCCCC(O)=O)1)(CCCCCCCC)C1 |
Physicochemical Information | |
Melting Point | 18 °C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in ether.<<0239>><<0240>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |