LBF19206SC01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0168 | |LipidBank=DFA0168 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0168 |
| LipidMaps | LMFA01030129 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF19206SC01.mol |
| |
| Structural Information | |
| Systematic Name | cis-10, cis-13-Nonadecadienoic acid |
| Common Name | |
| Symbol | |
| Formula | C19H34O2 |
| Exact Mass | 294.255880332 |
| Average Mass | 294.47206000000006 |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | <<0274>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
