LBF183nnXX01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0266 |
LipidMaps | LMFA01030197 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF183nnXX01.mol |
Gorlic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2-Cyclopentene-1-tridecenoic acid / 13- (2-cyclopenten-1-yl) tridecenoic acid / 13- (Cyclopent-2-enyl) -6-tridecenoic acid |
Common Name |
|
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | OC(=O)CCCCC=CCCCCCCC(C1)C=CC1 |
Physicochemical Information | |
Melting Point | 6.0 °C [Liquid] |
Boiling Point | 232.5 °C |
Density | dX4250.9436 |
Optical Rotation | 1.4782 at 25 °C |
Reflactive Index | |
Solubility | soluble in hot ethanol.<<0048>><<0107>><<0401>><<0402>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |