LBF18304SC03
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0193 | 
| LipidMaps | LMFA01030154 | 
| CAS | |
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18304SC03.mol | 
  
 | |
| Structural Information | |
| Systematic Name | 10, 12, 14-Octadecatrienoic acid | 
| Common Name | |
| Symbol | |
| Formula | C18H30O2 | 
| Exact Mass | 278.224580204 | 
| Average Mass | 278.4296 | 
| SMILES | CCCC=CC=CC=CCCCCCCCCC(O)=O | 
| Physicochemical Information | |
| Melting Point | 79°C | 
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | <<0276>><<0278>> | 
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
