LBF18303SC01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0191 | |LipidBank=DFA0191 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0191 |
| LipidMaps | LMFA01030152 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18303SC01.mol |
| alpha-Linolenic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-9, cis-12, cis-15-Octadecatrienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | -11.3 to -11°C |
| Boiling Point | 125°C at 0.05 mmHg |
| Density | dX420 0.9164 |
| Optical Rotation | 1.4678 at 50°C |
| Reflactive Index | |
| Solubility | soluble in acetone, ethanol, ether and petroleum ether.<<0400>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | Gas liquid chromatogram  (provided by Dr. Akiko Horiuchi). |
