LBF18205SC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0166 |
LipidMaps | LMFA01030127 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18205SC01.mol |
![]() | |
Structural Information | |
Systematic Name | cis-10, cis-13-Octadecadienoic acid |
Common Name | |
Symbol | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCC=CCC=CCCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | -9°C to -6.5°C |
Boiling Point | 121°C to 128°C at 0.0001mmHg |
Density | |
Optical Rotation | 1.4670 at 25°C |
Reflactive Index | |
Solubility | <<0194>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |