LBF18109OX01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8043 | |LipidBank=DFA8043 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8043 |
| LipidMaps | LMFA01060070 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18109OX01.mol |
| |
| Structural Information | |
| Systematic Name | 13-Hydroxy-12-Oxo-9-Octadecenoic Acid |
| Common Name | |
| Symbol | |
| Formula | C18H32O4 |
| Exact Mass | 312.23005951199997 |
| Average Mass | 312.44428 |
| SMILES | CCCCCC(O)C(=O)CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | l EtOH /max=226nm(e=2900Å }400), l EtOH /max=277nm(e=1300Å }200) <<8067>> |
| IR Spectra | |
| NMR Spectra | 1H-NMR<<8067>>: C8(2.00ppm), C9, 10(5.54ppm), C11(3.22ppm), C13(4.21ppm) |
| Chromatograms | |
