LBF18109HP01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8010 |
| LipidMaps | LMFA01040011 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18109HP01.mol |
| |
| Structural Information | |
| Systematic Name | 12,13-Epoxy-11-Hydroperoxy-9-Octadecenoic Acid |
| Common Name | |
| Symbol | |
| Formula | C18H32O5 |
| Exact Mass | 328.224974134 |
| Average Mass | 328.44368000000003 |
| SMILES | O(C1CCCCC)C(C(OO)C=CCCCCCCCC(O)=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methylation, reduction and trimethylsilylation)<<8052/8093>>: m/e= 285[SMTO=CH-CH=CH-(CH2)7COOCH3] |
| UV Spectra | |
| IR Spectra | After methylation and reduction<<8066/8013/8052>> |
| NMR Spectra | 1H-NMR(after methylation and reduction)<<8066/8013/8052>> |
| Chromatograms | |
