LBF18109HO06
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA8044 |
LipidMaps | LMFA01050149 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18109HO06.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl 9,12-Dihydroxy-13-Oxo-10-Octadecenoate |
Common Name | |
Symbol | |
Formula | C19H34O5 |
Exact Mass | 342.240624198 |
Average Mass | 342.47026000000005 |
SMILES | CCCCCC(=O)C(O)C=CC(O)CCCCCCCC(=O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(TMS)<<8056>>: m/e=486[M], 471[M-CH3], 455[M-OCH3], 386[M-C(O)(CH2)4CH3-H], 259[SMTO=CH-(CH2)7COOCH3] |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |