LBF18108HO05
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA8039 |
LipidMaps | LMFA01050136 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18108HO05.mol |
Structural Information | |
---|---|
Systematic Name | 9-Hydroxy-12-Oxo-10-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H32O4 |
Exact Mass | 312.23005951199997 |
Average Mass | 312.44428 |
SMILES | CCCCCCC(=O)C=CC(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | l EtOH /max=226nm(e=9900Å }1100),l EtOH /max=275nm(e=260Å }30) <<8067>> |
IR Spectra | Trans unsaturation(973cm-1), conjugated C=O(1617cm-1), OH(3460,1070cm-1) <<8067>> |
NMR Spectra | |
Chromatograms |