LBF18107OX01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA8041 |
LipidMaps | LMFA01060068 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18107OX01.mol |
Structural Information | |
---|---|
Systematic Name | 13-Hydroxy-9-Oxo-11-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H32O4 |
Exact Mass | 312.23005951199997 |
Average Mass | 312.44428 |
SMILES | CCCCCC(O)C=CCC(=O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8013/8071/8068>>: m/e=398[M], 383[M-CH3], 367[M-OCH3], 327[M-(CH2)4CH3], 241[M-(CH2)7COOCH3], 199[CH2CO(CH2)7COOCH3], 185[CO(CH2)7COOCH3], 173[SMTO=CH-(CH2)4CH3]GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation)<<8068>> |
UV Spectra | |
IR Spectra | Metyl ester(CS2): isolated trans olefin(970cm-1), keto carbonyl(1717cm-1), OH(3460cm-1) <<8013/8071>> |
NMR Spectra | 1H-NMR(methyl ester, trans ene)<<8013>>: C2, 8(2.33ppm), C10(3.11ppm), C11(5.7ppm) C12(5.56ppm), C13(4.08ppm) |
Chromatograms |