LBF18107HO05
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8045 | |LipidBank=DFA8045 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8045 |
LipidMaps | LMFA01050150 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18107HO05.mol |
Structural Information | |
---|---|
Systematic Name | Methyl 10,13-Dihydroxy-9-Oxo-11-Octadecenoate |
Common Name | |
Symbol | |
Formula | C19H34O5 |
Exact Mass | 342.240624198 |
Average Mass | 342.47026000000005 |
SMILES | CCCCCC(O)C=CC(O)C(=O)CCCCCCCC(=O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(TMS)<<8056>>: m/e=486[M], 471[M-CH3], 455[M-OCH3], 300[M-C(O)(CH2)7CH3-H], 173[SMTO=CH-(CH2)4CH3] |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |