LBF18106EO01
From Metabolomics.JP
(Difference between revisions)
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01070011 | |LipidMaps=LMFA01070011 | ||
|SysName=9,10-Epoxy-12-Octadecenoic Acid | |SysName=9,10-Epoxy-12-Octadecenoic Acid | ||
| − | | | + | |Common Name=&&9,10-Epoxy-12-Octadecenoic Acid&& |
|Mass Spectra=GC-EI-MS<<8017>>: m/e= 310[M], 279[M-OCH3], 199[M-CH3(CH2)4CH=CHCH2], 153[M-(CH2)7-COOCH3], GC-EI-MS(after solvolysation-trimethylsilylation in MeOH)<<8062>> | |Mass Spectra=GC-EI-MS<<8017>>: m/e= 310[M], 279[M-OCH3], 199[M-CH3(CH2)4CH=CHCH2], 153[M-(CH2)7-COOCH3], GC-EI-MS(after solvolysation-trimethylsilylation in MeOH)<<8062>> | ||
|IR Spectra=Olefinic(3002cm<SUP><FONT SIZE=-1>-</FONT></SUP><SUP><FONT SIZE=-1>1</FONT></SUP>), cis unsaturation(718cm<SUP><FONT SIZE=-1>-</FONT></SUP><SUP><FONT SIZE=-1>1</FONT></SUP>), cis epoxide(835-815cm<SUP><FONT SIZE=-1>-</FONT></SUP><SUP><FONT SIZE=-1>1</FONT></SUP>)<<8017>> | |IR Spectra=Olefinic(3002cm<SUP><FONT SIZE=-1>-</FONT></SUP><SUP><FONT SIZE=-1>1</FONT></SUP>), cis unsaturation(718cm<SUP><FONT SIZE=-1>-</FONT></SUP><SUP><FONT SIZE=-1>1</FONT></SUP>), cis epoxide(835-815cm<SUP><FONT SIZE=-1>-</FONT></SUP><SUP><FONT SIZE=-1>1</FONT></SUP>)<<8017>> | ||
|NMR Spectra=<SUP><FONT SIZE=-1>1</FONT></SUP>H-NMR<<8017>>: olefinic protons(5.44ppm), isolated cis epoxide(2.92ppm) | |NMR Spectra=<SUP><FONT SIZE=-1>1</FONT></SUP>H-NMR<<8017>>: olefinic protons(5.44ppm), isolated cis epoxide(2.92ppm) | ||
}} | }} | ||
Latest revision as of 15:36, 3 August 2010
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8007 |
| LipidMaps | LMFA01070011 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18106EO01.mol |
| 9,10-Epoxy-12-Octadecenoic Acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9,10-Epoxy-12-Octadecenoic Acid |
| Common Name |
|
| Symbol | |
| Formula | C18H32O3 |
| Exact Mass | 296.23514489 |
| Average Mass | 296.44488 |
| SMILES | C(C(CC=CCCCCC)1)(CCCCCCCC(O)=O)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS<<8017>>: m/e= 310[M], 279[M-OCH3], 199[M-CH3(CH2)4CH=CHCH2], 153[M-(CH2)7-COOCH3], GC-EI-MS(after solvolysation-trimethylsilylation in MeOH)<<8062>> |
| UV Spectra | |
| IR Spectra | Olefinic(3002cm-1), cis unsaturation(718cm-1), cis epoxide(835-815cm-1)<<8017>> |
| NMR Spectra | 1H-NMR<<8017>>: olefinic protons(5.44ppm), isolated cis epoxide(2.92ppm) |
| Chromatograms | |
