LBF18000HO28
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0369 |
LipidMaps | LMFA01050103 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18000HO28.mol |
Phloionolic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9,10,18-Trihydroxyoctadecanoic acid |
Common Name |
|
Symbol | |
Formula | C18H36O5 |
Exact Mass | 332.256274262 |
Average Mass | 332.47544 |
SMILES | OCCCCCCCCC(O)C(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 104°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0533>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |