LBF18000HO23
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0356 | |LipidBank=DFA0356 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0356 |
| LipidMaps | LMFA01050090 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18000HO23.mol |
| 9,10-Dihydroxystearic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9,10-Dihydroxyoctadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H36O4 |
| Exact Mass | 316.26135963999997 |
| Average Mass | 316.47604 |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 133-136.5°C (erythro) |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in alcohol, ethanol, hot water, methanol and alcohol<<0454>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
