LBF18000HO10
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0329 | |LipidBank=DFA0329 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0329 |
| LipidMaps | LMFA01050063 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18000HO10.mol |
| 11-Hydroxystearic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | DL-11-Hydroxyoctadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H36O3 |
| Exact Mass | 300.266445018 |
| Average Mass | 300.47664 |
| SMILES | CCCCCCCC(O)CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 81-82°C |
| Boiling Point | 204-206°C at 4 mm Hg |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in petroleum<<0060>><<0480>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
