LBF16114BC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7105 |
| LipidMaps | LMFA01020137 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF16114BC01.mol |
| Phytenoic Acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,7,11,15-Tetramethyl-2 (Z) -Hexadecenoic Acid |
| Common Name |
|
| Symbol | |
| Formula | C20H38O2 |
| Exact Mass | 310.28718046 |
| Average Mass | 310.51452 |
| SMILES | CC(CCCC(CCCC(CCCC(C)C)C)C)=CC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 210 - 220°C/11.5mmHg, 174°C/0.4mmHg <<7107>> |
| Density | D20/4 = 0.893 <<7107>> |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | , D20/4 = 0.893 <<7107>> |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
