LBF16000HO10
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0367 | |LipidBank=DFA0367 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0367 |
LipidMaps | LMFA01050101 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16000HO10.mol |
9,10,16-Trihydroxypalmitic acid/aleuritic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9,10,16-Trihydroxyhexadecanoic acid |
Common Name |
|
Symbol | |
Formula | C16H32O5 |
Exact Mass | 304.224974134 |
Average Mass | 304.42228 |
SMILES | OCCCCCCC(O)C(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 102°C/104°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in aqueous alcohol, methyl alcohol, ; needles from water. <<0373>>/<<0374>>/<<0375>>/<<0376>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |