LBF16000HO10
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0367 | |LipidBank=DFA0367 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0367 |
| LipidMaps | LMFA01050101 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF16000HO10.mol |
| 9,10,16-Trihydroxypalmitic acid/aleuritic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9,10,16-Trihydroxyhexadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C16H32O5 |
| Exact Mass | 304.224974134 |
| Average Mass | 304.42228 |
| SMILES | OCCCCCCC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 102°C/104°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in aqueous alcohol, methyl alcohol, ; needles from water. <<0373>>/<<0374>>/<<0375>>/<<0376>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
