LBF15000BC03
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA7009 |
LipidMaps | LMFA01020041 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF15000BC03.mol |
![]() | |
Structural Information | |
Systematic Name | 4,8-Dimethylpentadecanoic Acid |
Common Name | |
Symbol | |
Formula | C17H34O2 |
Exact Mass | 270.255880332 |
Average Mass | 270.45065999999997 |
SMILES | CCCCCCCC(C)CCCC(C)CCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | ![]() (provided by Dr. Takeshi Kasama). |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms | Gas chromatography <<7145>> |